5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride

C17H27ClO — CID 54440908

IUPAC5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride
SMILESCC(C)=CCCC(C)=CCCC(C)=CCCC(=O)Cl
InChIInChI=1S/C17H27ClO/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17(18)19/h8,10,12H,5-7,9,11,13H2,1-4H3
InChIKeyWOAFHTKZUQDUJD-UHFFFAOYSA-N
MW282.86 g/mol
LogP5.95
Rot. Bonds9

About 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride

5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride (PubChem CID 54440908) has the molecular formula C17H27ClO and a molecular weight of 282.86 g/mol. Its IUPAC name is 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride.

Molecular Properties

Compound Name5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride
PubChem CID54440908
Molecular FormulaC17H27ClO
Molecular Weight282.86 g/mol
Exact Mass282.18
IUPAC Name5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride
SMILESCC(C)=CCCC(C)=CCCC(C)=CCCC(=O)Cl
InChIInChI=1S/C17H27ClO/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17(18)19/h8,10,12H,5-7,9,11,13H2,1-4H3
InChIKeyWOAFHTKZUQDUJD-UHFFFAOYSA-N
XLogP5.95
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms19
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500282.86
LogP ≤ 55.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride?
The IUPAC name of 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride (CID 54440908) is 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride.
What is the SMILES notation for 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride?
The canonical SMILES for 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride is CC(C)=CCCC(C)=CCCC(C)=CCCC(=O)Cl.
What is the InChIKey of 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride?
The InChIKey is WOAFHTKZUQDUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27ClO/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17(18)19/h8,10,12H,5-7,9,11,13H2,1-4H3.
What are the key properties of 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride?
5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride has a molecular weight of 282.86 g/mol, XLogP of 5.95, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9,13-trimethyltetradeca-4,8,12-trienoyl chloride is sourced from PubChem (CID 54440908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).