C11H19Cl — CID 101240427
(6E)-9-chloro-2,6-dimethylnona-2,6-diene (PubChem CID 101240427) has the molecular formula C11H19Cl and a molecular weight of 186.73 g/mol. Its IUPAC name is (6E)-9-chloro-2,6-dimethylnona-2,6-diene.
| Compound Name | (6E)-9-chloro-2,6-dimethylnona-2,6-diene |
|---|---|
| PubChem CID | 101240427 |
| Molecular Formula | C11H19Cl |
| Molecular Weight | 186.73 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (6E)-9-chloro-2,6-dimethylnona-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CCCl |
| InChI | InChI=1S/C11H19Cl/c1-10(2)6-4-7-11(3)8-5-9-12/h6,8H,4-5,7,9H2,1-3H3/b11-8+ |
| InChIKey | FYRLSUNCRIPDKG-DHZHZOJOSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|