C16H27Cl — CID 118038499
(10E)-13-chloro-2,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 118038499) has the molecular formula C16H27Cl and a molecular weight of 254.84 g/mol. Its IUPAC name is (10E)-13-chloro-2,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | (10E)-13-chloro-2,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 118038499 |
| Molecular Formula | C16H27Cl |
| Molecular Weight | 254.84 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (10E)-13-chloro-2,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | CC(C)=CCCC(C)=CCC/C(C)=C/CCCl |
| InChI | InChI=1S/C16H27Cl/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17/h8,10,12H,5-7,9,11,13H2,1-4H3/b15-10?,16-12+ |
| InChIKey | NIKQMBWKCULQQE-SKJKBLLGSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.84 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|