C10H17Cl — CID 10535222
(2E)-1-chloro-1-deuterio-3,7-dimethylocta-2,6-diene (PubChem CID 10535222) has the molecular formula C10H17Cl and a molecular weight of 173.71 g/mol. Its IUPAC name is (2E)-1-chloro-1-deuterio-3,7-dimethylocta-2,6-diene.
| Compound Name | (2E)-1-chloro-1-deuterio-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 10535222 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 173.71 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2E)-1-chloro-1-deuterio-3,7-dimethylocta-2,6-diene |
| SMILES | [2H]C(Cl)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C10H17Cl/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+/i8D |
| InChIKey | WLAUCMCTKPXDIY-NNJAVUKISA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.71 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|