C10H17Cl3Si — CID 57376626
trichloro(3,7-dimethylocta-2,6-dienyl)silane (PubChem CID 57376626) has the molecular formula C10H17Cl3Si and a molecular weight of 271.69 g/mol. Its IUPAC name is trichloro(3,7-dimethylocta-2,6-dienyl)silane.
| Compound Name | trichloro(3,7-dimethylocta-2,6-dienyl)silane |
|---|---|
| PubChem CID | 57376626 |
| Molecular Formula | C10H17Cl3Si |
| Molecular Weight | 271.69 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | trichloro(3,7-dimethylocta-2,6-dienyl)silane |
| SMILES | CC(C)=CCCC(C)=CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C10H17Cl3Si/c1-9(2)5-4-6-10(3)7-8-14(11,12)13/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | GKYNOXGCIYHMEZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|