C19H31Cl — CID 58792351
(2E,6Z)-1-chloro-3,11-dimethyl-7-(3-methylbut-2-enyl)dodeca-2,6,10-triene (PubChem CID 58792351) has the molecular formula C19H31Cl and a molecular weight of 294.91 g/mol. Its IUPAC name is (2E,6Z)-1-chloro-3,11-dimethyl-7-(3-methylbut-2-enyl)dodeca-2,6,10-triene.
| Compound Name | (2E,6Z)-1-chloro-3,11-dimethyl-7-(3-methylbut-2-enyl)dodeca-2,6,10-triene |
|---|---|
| PubChem CID | 58792351 |
| Molecular Formula | C19H31Cl |
| Molecular Weight | 294.91 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (2E,6Z)-1-chloro-3,11-dimethyl-7-(3-methylbut-2-enyl)dodeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(=C/CC/C(C)=C/CCl)CC=C(C)C |
| InChI | InChI=1S/C19H31Cl/c1-16(2)8-6-10-19(13-12-17(3)4)11-7-9-18(5)14-15-20/h8,11-12,14H,6-7,9-10,13,15H2,1-5H3/b18-14+,19-11- |
| InChIKey | LBZZMRVWIMDMJK-QCHOSADPSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.91 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|