C22H37NO — CID 173416553
5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenamide (PubChem CID 173416553) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenamide.
| Compound Name | 5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenamide |
|---|---|
| PubChem CID | 173416553 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(N)=O |
| InChI | InChI=1S/C22H37NO/c1-18(2)10-6-11-19(3)12-7-13-20(4)14-8-15-21(5)16-9-17-22(23)24/h10,12,14,16H,6-9,11,13,15,17H2,1-5H3,(H2,23,24) |
| InChIKey | YURAVFNZSUDMQI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|