C47H76O2 — CID 78421842
3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl acetate (PubChem CID 78421842) has the molecular formula C47H76O2 and a molecular weight of 673.12 g/mol. Its IUPAC name is 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl acetate.
| Compound Name | 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl acetate |
|---|---|
| PubChem CID | 78421842 |
| Molecular Formula | C47H76O2 |
| Molecular Weight | 673.12 g/mol |
| Exact Mass | 672.58 |
| IUPAC Name | 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl acetate |
| SMILES | CC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C47H76O2/c1-38(2)20-12-21-39(3)22-13-23-40(4)24-14-25-41(5)26-15-27-42(6)28-16-29-43(7)30-17-31-44(8)32-18-33-45(9)34-19-35-46(10)36-37-49-47(11)48/h20,22,24,26,28,30,32,34,36H,12-19,21,23,25,27,29,31,33,35,37H2,1-11H3 |
| InChIKey | JQXXWBAHSBAIEK-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.12 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|