C24H38O4 — CID 57495010
bis[(2Z)-3,7-dimethylocta-2,6-dienyl] butanedioate (PubChem CID 57495010) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is bis[(2Z)-3,7-dimethylocta-2,6-dienyl] butanedioate.
| Compound Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] butanedioate |
|---|---|
| PubChem CID | 57495010 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] butanedioate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CCC(=O)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C24H38O4/c1-19(2)9-7-11-21(5)15-17-27-23(25)13-14-24(26)28-18-16-22(6)12-8-10-20(3)4/h9-10,15-16H,7-8,11-14,17-18H2,1-6H3/b21-15-,22-16- |
| InChIKey | WCOGJMOUNVGCLA-BMJUYKDLSA-N |
| XLogP | 6.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|