C24H40O2 — CID 91565199
3,7-dimethylocta-2,6-dienyl 7,11-dimethyldodeca-6,10-dienoate (PubChem CID 91565199) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 7,11-dimethyldodeca-6,10-dienoate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 7,11-dimethyldodeca-6,10-dienoate |
|---|---|
| PubChem CID | 91565199 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 7,11-dimethyldodeca-6,10-dienoate |
| SMILES | CC(C)=CCCC(C)=CCCCCC(=O)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C24H40O2/c1-20(2)12-10-15-22(5)14-8-7-9-17-24(25)26-19-18-23(6)16-11-13-21(3)4/h12-14,18H,7-11,15-17,19H2,1-6H3 |
| InChIKey | HIXFLPCTARWSAY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|