C23H40O2 — CID 59612659
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 5,5-dimethylhexanoate (PubChem CID 59612659) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 5,5-dimethylhexanoate.
| Compound Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 59612659 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 5,5-dimethylhexanoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(=O)CCCC(C)(C)C |
| InChI | InChI=1S/C23H40O2/c1-19(2)11-8-12-20(3)13-9-14-21(4)16-18-25-22(24)15-10-17-23(5,6)7/h11,13,16H,8-10,12,14-15,17-18H2,1-7H3/b20-13+,21-16+ |
| InChIKey | JQSLXCXCKCHVJY-QUIOSVDYSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|