C27H47AlO2 — CID 173458280
alumane;[(2E)-3,7-dimethylocta-2,6-dienyl] (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienoate (PubChem CID 173458280) has the molecular formula C27H47AlO2 and a molecular weight of 430.65 g/mol. Its IUPAC name is alumane;[(2E)-3,7-dimethylocta-2,6-dienyl] (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienoate.
| Compound Name | alumane;[(2E)-3,7-dimethylocta-2,6-dienyl] (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 173458280 |
| Molecular Formula | C27H47AlO2 |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | alumane;[(2E)-3,7-dimethylocta-2,6-dienyl] (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(=O)OC/C=C(\C)CCC=C(C)C.[AlH3] |
| InChI | InChI=1S/C27H44O2.Al.3H/c1-22(2)12-8-14-24(5)16-10-17-25(6)18-11-19-27(28)29-21-20-26(7)15-9-13-23(3)4;;;;/h12-13,16,18,20H,8-11,14-15,17,19,21H2,1-7H3;;;;/b24-16+,25-18+,26-20+;;;; |
| InChIKey | XJHRUUSOXUZRDZ-ZJXNYCSBSA-N |
| XLogP | 7.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|