C62H100O2 — CID 24837329
[(2E,6Z,10E,14Z,18Z,22E,26E,30Z,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] (4Z)-5,9-dimethyldeca-4,8-dienoate (PubChem CID 24837329) has the molecular formula C62H100O2 and a molecular weight of 877.48 g/mol. Its IUPAC name is [(2E,6Z,10E,14Z,18Z,22E,26E,30Z,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] (4Z)-5,9-dimethyldeca-4,8-dienoate.
| Compound Name | [(2E,6Z,10E,14Z,18Z,22E,26E,30Z,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] (4Z)-5,9-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 24837329 |
| Molecular Formula | C62H100O2 |
| Molecular Weight | 877.48 g/mol |
| Exact Mass | 876.77 |
| IUPAC Name | [(2E,6Z,10E,14Z,18Z,22E,26E,30Z,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] (4Z)-5,9-dimethyldeca-4,8-dienoate |
| SMILES | CC(C)=CCC/C(C)=C\CCC(=O)OC/C=C(\C)CC/C=C(/C)CC/C=C(\C)CC/C=C(/C)CC/C=C(/C)CC/C=C(\C)CC/C=C(\C)CC/C=C(/C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C62H100O2/c1-50(2)26-15-28-52(5)30-17-31-54(7)32-18-33-55(8)34-19-35-56(9)36-20-37-57(10)38-21-39-58(11)40-22-41-59(12)42-23-43-60(13)44-24-45-61(14)48-49-64-62(63)47-25-46-53(6)29-16-27-51(3)4/h26-27,30,32,34,36,38,40,42,44,46,48H,15-25,28-29,31,33,35,37,39,41,43,45,47,49H2,1-14H3/b52-30+,53-46-,54-32-,55-34+,56-36+,57-38-,58-40-,59-42+,60-44-,61-48+ |
| InChIKey | RSASHPJWQNBHFW-ZWUVVZCOSA-N |
| XLogP | 20.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.48 |
| LogP ≤ 5 | 20.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|