C18H30O2S — CID 57047434
3,7,11-trimethyldodeca-2,6,10-trienyl 3-sulfanylpropanoate (PubChem CID 57047434) has the molecular formula C18H30O2S and a molecular weight of 310.50 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-trienyl 3-sulfanylpropanoate.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-trienyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 57047434 |
| Molecular Formula | C18H30O2S |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-trienyl 3-sulfanylpropanoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC(=O)CCS |
| InChI | InChI=1S/C18H30O2S/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-13-20-18(19)12-14-21/h7,9,11,21H,5-6,8,10,12-14H2,1-4H3 |
| InChIKey | NNPNXWNIAWIFAO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|