C17H29NO2 — CID 46937945
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-aminoacetate (PubChem CID 46937945) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-aminoacetate.
| Compound Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-aminoacetate |
|---|---|
| PubChem CID | 46937945 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-aminoacetate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(=O)CN |
| InChI | InChI=1S/C17H29NO2/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-20-17(19)13-18/h7,9,11H,5-6,8,10,12-13,18H2,1-4H3/b15-9+,16-11+ |
| InChIKey | BEFPDOXWGZYYNP-XGGJEREUSA-N |
| XLogP | 3.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|