C24H39NO4 — CID 140995074
[(2E)-3,7-dimethylocta-2,6-dienyl] 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxoethyl]amino]acetate (PubChem CID 140995074) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxoethyl]amino]acetate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 140995074 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxoethyl]amino]acetate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CNCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H39NO4/c1-19(2)9-7-11-21(5)13-15-28-23(26)17-25-18-24(27)29-16-14-22(6)12-8-10-20(3)4/h9-10,13-14,25H,7-8,11-12,15-18H2,1-6H3/b21-13+,22-14+ |
| InChIKey | ODRYXNCSPHUSAQ-JFMUQQRKSA-N |
| XLogP | 5.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|