C26H42O4 — CID 102530693
bis[(2Z)-3,7-dimethylocta-2,6-dienyl] hexanedioate (PubChem CID 102530693) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is bis[(2Z)-3,7-dimethylocta-2,6-dienyl] hexanedioate.
| Compound Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] hexanedioate |
|---|---|
| PubChem CID | 102530693 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] hexanedioate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CCCCC(=O)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C26H42O4/c1-21(2)11-9-13-23(5)17-19-29-25(27)15-7-8-16-26(28)30-20-18-24(6)14-10-12-22(3)4/h11-12,17-18H,7-10,13-16,19-20H2,1-6H3/b23-17-,24-18- |
| InChIKey | AIGDAVPUHJZLAZ-BOYKQRMESA-N |
| XLogP | 7.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|