C28H50O4 — CID 91695258
10-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-octyl decanedioate (PubChem CID 91695258) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is 10-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-octyl decanedioate.
| Compound Name | 10-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-octyl decanedioate |
|---|---|
| PubChem CID | 91695258 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | 10-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-octyl decanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H50O4/c1-5-6-7-8-13-16-23-31-27(29)20-14-11-9-10-12-15-21-28(30)32-24-22-26(4)19-17-18-25(2)3/h18,22H,5-17,19-21,23-24H2,1-4H3/b26-22+ |
| InChIKey | JSJWROOUELPWER-XTCLZLMSSA-N |
| XLogP | 8.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|