C24H34O4 — CID 91736860
4-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-hexyl benzene-1,4-dicarboxylate (PubChem CID 91736860) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 4-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-hexyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-hexyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91736860 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 4-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-hexyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)OC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C24H34O4/c1-5-6-7-8-17-27-23(25)21-12-14-22(15-13-21)24(26)28-18-16-20(4)11-9-10-19(2)3/h10,12-16H,5-9,11,17-18H2,1-4H3/b20-16+ |
| InChIKey | YISLKVZIIJRVFT-CAPFRKAQSA-N |
| XLogP | 6.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|