C17H23NO2 — CID 18604951
[(2E)-3,7-dimethylocta-2,6-dienyl] 4-aminobenzoate (PubChem CID 18604951) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 4-aminobenzoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 18604951 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 4-aminobenzoate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H23NO2/c1-13(2)5-4-6-14(3)11-12-20-17(19)15-7-9-16(18)10-8-15/h5,7-11H,4,6,12,18H2,1-3H3/b14-11+ |
| InChIKey | QDNMRFWGNBEONF-SDNWHVSQSA-N |
| XLogP | 4.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|