C18H22O3 — CID 140658272
3,7-dimethylocta-2,6-dienyl 2-oxo-2-phenylacetate (PubChem CID 140658272) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 2-oxo-2-phenylacetate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 140658272 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 2-oxo-2-phenylacetate |
| SMILES | CC(C)=CCCC(C)=CCOC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-14(2)8-7-9-15(3)12-13-21-18(20)17(19)16-10-5-4-6-11-16/h4-6,8,10-12H,7,9,13H2,1-3H3 |
| InChIKey | ULKRWXKBORSJBF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|