C19H26O — CID 102207934
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]prop-1-en-2-ylbenzene (PubChem CID 102207934) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]prop-1-en-2-ylbenzene.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 102207934 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]prop-1-en-2-ylbenzene |
| SMILES | C=C(COC/C=C(\C)CCC=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H26O/c1-16(2)9-8-10-17(3)13-14-20-15-18(4)19-11-6-5-7-12-19/h5-7,9,11-13H,4,8,10,14-15H2,1-3H3/b17-13+ |
| InChIKey | BNNLXUVTYGXHAQ-GHRIWEEISA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|