C12H22O2 — CID 3018010
1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene (PubChem CID 3018010) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene.
| Compound Name | 1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 3018010 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene |
| SMILES | COCOCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C12H22O2/c1-11(2)6-5-7-12(3)8-9-14-10-13-4/h6,8H,5,7,9-10H2,1-4H3 |
| InChIKey | SAKWOVITFRSKER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|