C31H54O3Si — CID 3017007
tris(3,7-dimethylocta-2,6-dienoxy)methylsilane (PubChem CID 3017007) has the molecular formula C31H54O3Si and a molecular weight of 502.86 g/mol. Its IUPAC name is tris(3,7-dimethylocta-2,6-dienoxy)methylsilane.
| Compound Name | tris(3,7-dimethylocta-2,6-dienoxy)methylsilane |
|---|---|
| PubChem CID | 3017007 |
| Molecular Formula | C31H54O3Si |
| Molecular Weight | 502.86 g/mol |
| Exact Mass | 502.38 |
| IUPAC Name | tris(3,7-dimethylocta-2,6-dienoxy)methylsilane |
| SMILES | CC(C)=CCCC(C)=CCOC([SiH3])(OCC=C(C)CCC=C(C)C)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C31H54O3Si/c1-25(2)13-10-16-28(7)19-22-32-31(35,33-23-20-29(8)17-11-14-26(3)4)34-24-21-30(9)18-12-15-27(5)6/h13-15,19-21H,10-12,16-18,22-24H2,1-9,35H3 |
| InChIKey | GGROZWRGSRXIJC-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.86 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|