C30H51BO3 — CID 6436996
bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate (PubChem CID 6436996) has the molecular formula C30H51BO3 and a molecular weight of 470.55 g/mol. Its IUPAC name is bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate.
| Compound Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate |
|---|---|
| PubChem CID | 6436996 |
| Molecular Formula | C30H51BO3 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate |
| SMILES | CC(C)=CCC/C(C)=C\COB(OC/C=C(/C)CCC=C(C)C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H51BO3/c1-25(2)13-10-16-28(7)19-22-32-31(33-23-20-29(8)17-11-14-26(3)4)34-24-21-30(9)18-12-15-27(5)6/h13-15,19-21H,10-12,16-18,22-24H2,1-9H3/b28-19-,29-20-,30-21+ |
| InChIKey | PKMAPPRYHGGQHW-VNORTNIJSA-N |
| XLogP | 9.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|