C21H36O3S — CID 71736876
[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] methanesulfonate (PubChem CID 71736876) has the molecular formula C21H36O3S and a molecular weight of 368.58 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] methanesulfonate.
| Compound Name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] methanesulfonate |
|---|---|
| PubChem CID | 71736876 |
| Molecular Formula | C21H36O3S |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] methanesulfonate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COS(C)(=O)=O |
| InChI | InChI=1S/C21H36O3S/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-24-25(6,22)23/h10,12,14,16H,7-9,11,13,15,17H2,1-6H3/b19-12+,20-14+,21-16+ |
| InChIKey | QSGPOKKRYAUEDY-RFRQLJORSA-N |
| XLogP | 6.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|