C12H22O3S — CID 10634187
[(2E,6Z)-3,7-dimethylnona-2,6-dienyl] methanesulfonate (PubChem CID 10634187) has the molecular formula C12H22O3S and a molecular weight of 246.37 g/mol. Its IUPAC name is [(2E,6Z)-3,7-dimethylnona-2,6-dienyl] methanesulfonate.
| Compound Name | [(2E,6Z)-3,7-dimethylnona-2,6-dienyl] methanesulfonate |
|---|---|
| PubChem CID | 10634187 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [(2E,6Z)-3,7-dimethylnona-2,6-dienyl] methanesulfonate |
| SMILES | CC/C(C)=C\CC/C(C)=C/COS(C)(=O)=O |
| InChI | InChI=1S/C12H22O3S/c1-5-11(2)7-6-8-12(3)9-10-15-16(4,13)14/h7,9H,5-6,8,10H2,1-4H3/b11-7-,12-9+ |
| InChIKey | SNGXKPONUNZWRP-VNPQWULESA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|