C13H22O6S — CID 154630188
1-hydroxy-2,6-dimethyl-8-propanoyloxyocta-2,6-diene-1-sulfonic acid (PubChem CID 154630188) has the molecular formula C13H22O6S and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-hydroxy-2,6-dimethyl-8-propanoyloxyocta-2,6-diene-1-sulfonic acid.
| Compound Name | 1-hydroxy-2,6-dimethyl-8-propanoyloxyocta-2,6-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 154630188 |
| Molecular Formula | C13H22O6S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-hydroxy-2,6-dimethyl-8-propanoyloxyocta-2,6-diene-1-sulfonic acid |
| SMILES | CCC(=O)OCC=C(C)CCC=C(C)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C13H22O6S/c1-4-12(14)19-9-8-10(2)6-5-7-11(3)13(15)20(16,17)18/h7-8,13,15H,4-6,9H2,1-3H3,(H,16,17,18) |
| InChIKey | KXUVLQDULCRGBH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|