C13H19NaO6S — CID 154630195
sodium 1-hydroxy-2,6-dimethyl-8-prop-2-enoyloxyocta-2,6-diene-1-sulfonate (PubChem CID 154630195) has the molecular formula C13H19NaO6S and a molecular weight of 326.35 g/mol. Its IUPAC name is sodium 1-hydroxy-2,6-dimethyl-8-prop-2-enoyloxyocta-2,6-diene-1-sulfonate.
| Compound Name | sodium 1-hydroxy-2,6-dimethyl-8-prop-2-enoyloxyocta-2,6-diene-1-sulfonate |
|---|---|
| PubChem CID | 154630195 |
| Molecular Formula | C13H19NaO6S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | sodium 1-hydroxy-2,6-dimethyl-8-prop-2-enoyloxyocta-2,6-diene-1-sulfonate |
| SMILES | C=CC(=O)OCC=C(C)CCC=C(C)C(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H20O6S.Na/c1-4-12(14)19-9-8-10(2)6-5-7-11(3)13(15)20(16,17)18;/h4,7-8,13,15H,1,5-6,9H2,2-3H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | WNSGOUKRARADNE-UHFFFAOYSA-M |
| XLogP | -1.74 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|