C14H23NaO4S — CID 140603450
sodium (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonate (PubChem CID 140603450) has the molecular formula C14H23NaO4S and a molecular weight of 310.39 g/mol. Its IUPAC name is sodium (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonate.
| Compound Name | sodium (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonate |
|---|---|
| PubChem CID | 140603450 |
| Molecular Formula | C14H23NaO4S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | sodium (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonate |
| SMILES | CC(C)=CCC/C(C)=C/C/C=C(\C)C(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H24O4S.Na/c1-11(2)7-5-8-12(3)9-6-10-13(4)14(15)19(16,17)18;/h7,9-10,14-15H,5-6,8H2,1-4H3,(H,16,17,18);/q;+1/p-1/b12-9+,13-10+; |
| InChIKey | PKTOUOSAZNILHV-OGFFKXAGSA-M |
| XLogP | -0.12 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|