C26H44O3S — CID 54376862
3,7,11,15,19-pentamethyl-1-methylsulfonylicosa-2,6,10,14,18-pentaen-1-ol (PubChem CID 54376862) has the molecular formula C26H44O3S and a molecular weight of 436.70 g/mol. Its IUPAC name is 3,7,11,15,19-pentamethyl-1-methylsulfonylicosa-2,6,10,14,18-pentaen-1-ol.
| Compound Name | 3,7,11,15,19-pentamethyl-1-methylsulfonylicosa-2,6,10,14,18-pentaen-1-ol |
|---|---|
| PubChem CID | 54376862 |
| Molecular Formula | C26H44O3S |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 3,7,11,15,19-pentamethyl-1-methylsulfonylicosa-2,6,10,14,18-pentaen-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(O)S(C)(=O)=O |
| InChI | InChI=1S/C26H44O3S/c1-21(2)12-8-13-22(3)14-9-15-23(4)16-10-17-24(5)18-11-19-25(6)20-26(27)30(7,28)29/h12,14,16,18,20,26-27H,8-11,13,15,17,19H2,1-7H3 |
| InChIKey | UXDAPKIPRUOPEJ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|