C15H27O4P — CID 125183305
[(1R,2Z,6Z)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphonic acid (PubChem CID 125183305) has the molecular formula C15H27O4P and a molecular weight of 302.35 g/mol. Its IUPAC name is [(1R,2Z,6Z)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphonic acid.
| Compound Name | [(1R,2Z,6Z)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 125183305 |
| Molecular Formula | C15H27O4P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(1R,2Z,6Z)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\[C@H](O)P(=O)(O)O |
| InChI | InChI=1S/C15H27O4P/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)20(17,18)19/h7,9,11,15-16H,5-6,8,10H2,1-4H3,(H2,17,18,19)/b13-9-,14-11-/t15-/m1/s1 |
| InChIKey | MONZTFSZTWQCKH-PITDBZJHSA-N |
| XLogP | 3.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|