C30H54O7P2 — CID 173057958
2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;phosphono dihydrogen phosphate (PubChem CID 173057958) has the molecular formula C30H54O7P2 and a molecular weight of 588.70 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;phosphono dihydrogen phosphate.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 173057958 |
| Molecular Formula | C30H54O7P2 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;phosphono dihydrogen phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C30H50.H4O7P2/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4;1-8(2,3)7-9(4,5)6/h15-18,23-24H,9-14,19-22H2,1-8H3;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | JANNAQPPQSHSAF-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|