C15H28O7P2 — CID 90389130
(6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;phosphono dihydrogen phosphate (PubChem CID 90389130) has the molecular formula C15H28O7P2 and a molecular weight of 382.33 g/mol. Its IUPAC name is (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;phosphono dihydrogen phosphate.
| Compound Name | (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 90389130 |
| Molecular Formula | C15H28O7P2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;phosphono dihydrogen phosphate |
| SMILES | C=CC(=C)CC/C=C(\C)CCC=C(C)C.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H24.H4O7P2/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3;1-8(2,3)7-9(4,5)6/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3;(H2,1,2,3)(H2,4,5,6)/b15-12+; |
| InChIKey | HXTQOBJGSAPNLS-JRUHLWALSA-N |
| XLogP | 4.39 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|