C31H52 — CID 158402923
(6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;methane;(3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene (PubChem CID 158402923) has the molecular formula C31H52 and a molecular weight of 424.76 g/mol. Its IUPAC name is (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;methane;(3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene.
| Compound Name | (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;methane;(3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
|---|---|
| PubChem CID | 158402923 |
| Molecular Formula | C31H52 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.41 |
| IUPAC Name | (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene;methane;(3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
| SMILES | C.C=C/C(C)=C/C/C=C(\C)CCC=C(C)C.C=CC(=C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/2C15H24.CH4/c2*1-6-14(4)10-8-12-15(5)11-7-9-13(2)3;/h6,9-10,12H,1,7-8,11H2,2-5H3;6,9,12H,1,4,7-8,10-11H2,2-3,5H3;1H4/b14-10+,15-12+;15-12+; |
| InChIKey | GYIBGFZQJRKKBU-CMRAZTEISA-N |
| XLogP | 11.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|