C17H28 — CID 22236783
(3E,6E,10E)-7-ethyl-3,11-dimethyltrideca-1,3,6,10-tetraene (PubChem CID 22236783) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (3E,6E,10E)-7-ethyl-3,11-dimethyltrideca-1,3,6,10-tetraene.
| Compound Name | (3E,6E,10E)-7-ethyl-3,11-dimethyltrideca-1,3,6,10-tetraene |
|---|---|
| PubChem CID | 22236783 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (3E,6E,10E)-7-ethyl-3,11-dimethyltrideca-1,3,6,10-tetraene |
| SMILES | C=C/C(C)=C/C/C=C(\CC)CC/C=C(\C)CC |
| InChI | InChI=1S/C17H28/c1-6-15(4)11-9-13-17(8-3)14-10-12-16(5)7-2/h6,11-13H,1,7-10,14H2,2-5H3/b15-11+,16-12+,17-13+ |
| InChIKey | DSFNZXRWOVOIGV-GWZYDACJSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|