C20H36 — CID 174988182
3,7-dimethyloctadeca-1,3,6-triene (PubChem CID 174988182) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 3,7-dimethyloctadeca-1,3,6-triene.
| Compound Name | 3,7-dimethyloctadeca-1,3,6-triene |
|---|---|
| PubChem CID | 174988182 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 3,7-dimethyloctadeca-1,3,6-triene |
| SMILES | C=CC(C)=CCC=C(C)CCCCCCCCCCC |
| InChI | InChI=1S/C20H36/c1-5-7-8-9-10-11-12-13-14-16-20(4)18-15-17-19(3)6-2/h6,17-18H,2,5,7-16H2,1,3-4H3 |
| InChIKey | VFFURSNVNFOSBT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|