About 4-methylheptadec-3-ene
4-methylheptadec-3-ene (PubChem CID 59169426) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is 4-methylheptadec-3-ene.
Molecular Properties
| Compound Name | 4-methylheptadec-3-ene |
| PubChem CID | 59169426 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 4-methylheptadec-3-ene |
| SMILES | CCC=C(C)CCCCCCCCCCCCC |
| InChI | InChI=1S/C18H36/c1-4-6-7-8-9-10-11-12-13-14-15-17-18(3)16-5-2/h16H,4-15,17H2,1-3H3 |
| InChIKey | ZUVHSDMTENLMCL-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptadec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptadec-3-ene?
The IUPAC name of 4-methylheptadec-3-ene (CID 59169426) is 4-methylheptadec-3-ene.
What is the SMILES notation for 4-methylheptadec-3-ene?
The canonical SMILES for 4-methylheptadec-3-ene is CCC=C(C)CCCCCCCCCCCCC.
What is the InChIKey of 4-methylheptadec-3-ene?
The InChIKey is ZUVHSDMTENLMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36/c1-4-6-7-8-9-10-11-12-13-14-15-17-18(3)16-5-2/h16H,4-15,17H2,1-3H3.
What are the key properties of 4-methylheptadec-3-ene?
4-methylheptadec-3-ene has a molecular weight of 252.49 g/mol, XLogP of 7.04, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptadec-3-ene is sourced from PubChem (CID 59169426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).