About (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene
(E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene (PubChem CID 54602757) has the molecular formula C32H64
and a molecular weight of 448.86 g/mol. Its IUPAC name is (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene.
Molecular Properties
| Compound Name | (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene |
| PubChem CID | 54602757 |
| Molecular Formula | C32H64 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.50 |
| IUPAC Name | (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene |
| SMILES | CCCC/C=C(\C)CCCCCCCCC.CCCCCCCC/C=C(\C)CCCCC |
| InChI | InChI=1S/2C16H32/c2*1-4-6-8-9-10-11-13-15-16(3)14-12-7-5-2/h15H,4-14H2,1-3H3;14H,4-13,15H2,1-3H3/b16-15+;16-14+ |
| InChIKey | KDRCWPTUPORZDU-GGCIBKKJSA-N |
| XLogP | 12.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene?
The IUPAC name of (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene (CID 54602757) is (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene.
What is the SMILES notation for (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene?
The canonical SMILES for (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene is CCCC/C=C(\C)CCCCCCCCC.CCCCCCCC/C=C(\C)CCCCC.
What is the InChIKey of (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene?
The InChIKey is KDRCWPTUPORZDU-GGCIBKKJSA-N. The full InChI is InChI=1S/2C16H32/c2*1-4-6-8-9-10-11-13-15-16(3)14-12-7-5-2/h15H,4-14H2,1-3H3;14H,4-13,15H2,1-3H3/b16-15+;16-14+.
What are the key properties of (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene?
(E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene has a molecular weight of 448.86 g/mol, XLogP of 12.53, 22 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-methylpentadec-5-ene;(E)-6-methylpentadec-6-ene is sourced from PubChem (CID 54602757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).