C26H50N+ — CID 164597882
[(5E,8Z)-9-ethenyl-5-methyldodeca-5,8-dienyl]-diethyl-heptylazanium (PubChem CID 164597882) has the molecular formula C26H50N+ and a molecular weight of 376.69 g/mol. Its IUPAC name is [(5E,8Z)-9-ethenyl-5-methyldodeca-5,8-dienyl]-diethyl-heptylazanium.
| Compound Name | [(5E,8Z)-9-ethenyl-5-methyldodeca-5,8-dienyl]-diethyl-heptylazanium |
|---|---|
| PubChem CID | 164597882 |
| Molecular Formula | C26H50N+ |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.39 |
| IUPAC Name | [(5E,8Z)-9-ethenyl-5-methyldodeca-5,8-dienyl]-diethyl-heptylazanium |
| SMILES | C=C/C(=C\C/C=C(\C)CCCC[N+](CC)(CC)CCCCCCC)CCC |
| InChI | InChI=1S/C26H50N/c1-7-12-13-14-16-23-27(10-4,11-5)24-17-15-20-25(6)21-18-22-26(9-3)19-8-2/h9,21-22H,3,7-8,10-20,23-24H2,1-2,4-6H3/q+1/b25-21+,26-22+ |
| InChIKey | KBJNZWNWQDXXHN-CDTUYSNOSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|