About diethyl(dipentyl)azanium bromide
diethyl(dipentyl)azanium bromide (PubChem CID 87777355) has the molecular formula C14H32BrN
and a molecular weight of 294.32 g/mol. Its IUPAC name is diethyl(dipentyl)azanium bromide.
Molecular Properties
| Compound Name | diethyl(dipentyl)azanium bromide |
| PubChem CID | 87777355 |
| Molecular Formula | C14H32BrN |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | diethyl(dipentyl)azanium bromide |
| SMILES | CCCCC[N+](CC)(CC)CCCCC.[Br-] |
| InChI | InChI=1S/C14H32N.BrH/c1-5-9-11-13-15(7-3,8-4)14-12-10-6-2;/h5-14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | CWAGOYXAEAMVBM-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl(dipentyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(dipentyl)azanium bromide?
The IUPAC name of diethyl(dipentyl)azanium bromide (CID 87777355) is diethyl(dipentyl)azanium bromide.
What is the SMILES notation for diethyl(dipentyl)azanium bromide?
The canonical SMILES for diethyl(dipentyl)azanium bromide is CCCCC[N+](CC)(CC)CCCCC.[Br-].
What is the InChIKey of diethyl(dipentyl)azanium bromide?
The InChIKey is CWAGOYXAEAMVBM-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H32N.BrH/c1-5-9-11-13-15(7-3,8-4)14-12-10-6-2;/h5-14H2,1-4H3;1H/q+1;/p-1.
What are the key properties of diethyl(dipentyl)azanium bromide?
diethyl(dipentyl)azanium bromide has a molecular weight of 294.32 g/mol, XLogP of 1.23, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(dipentyl)azanium bromide is sourced from PubChem (CID 87777355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).