About diethyl(dioctyl)azanium fluoride
diethyl(dioctyl)azanium fluoride (PubChem CID 19602103) has the molecular formula C20H44FN
and a molecular weight of 317.58 g/mol. Its IUPAC name is diethyl(dioctyl)azanium fluoride.
Molecular Properties
| Compound Name | diethyl(dioctyl)azanium fluoride |
| PubChem CID | 19602103 |
| Molecular Formula | C20H44FN |
| Molecular Weight | 317.58 g/mol |
| Exact Mass | 317.35 |
| IUPAC Name | diethyl(dioctyl)azanium fluoride |
| SMILES | CCCCCCCC[N+](CC)(CC)CCCCCCCC.[F-] |
| InChI | InChI=1S/C20H44N.FH/c1-5-9-11-13-15-17-19-21(7-3,8-4)20-18-16-14-12-10-6-2;/h5-20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DBKKQCKAFCFRPJ-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl(dioctyl)azanium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(dioctyl)azanium fluoride?
The IUPAC name of diethyl(dioctyl)azanium fluoride (CID 19602103) is diethyl(dioctyl)azanium fluoride.
What is the SMILES notation for diethyl(dioctyl)azanium fluoride?
The canonical SMILES for diethyl(dioctyl)azanium fluoride is CCCCCCCC[N+](CC)(CC)CCCCCCCC.[F-].
What is the InChIKey of diethyl(dioctyl)azanium fluoride?
The InChIKey is DBKKQCKAFCFRPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H44N.FH/c1-5-9-11-13-15-17-19-21(7-3,8-4)20-18-16-14-12-10-6-2;/h5-20H2,1-4H3;1H/q+1;/p-1.
What are the key properties of diethyl(dioctyl)azanium fluoride?
diethyl(dioctyl)azanium fluoride has a molecular weight of 317.58 g/mol, XLogP of 3.57, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(dioctyl)azanium fluoride is sourced from PubChem (CID 19602103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).