C13H24 — CID 13382661
(3Z)-3-methyldodeca-1,3-diene (PubChem CID 13382661) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3Z)-3-methyldodeca-1,3-diene.
| Compound Name | (3Z)-3-methyldodeca-1,3-diene |
|---|---|
| PubChem CID | 13382661 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3Z)-3-methyldodeca-1,3-diene |
| SMILES | C=C/C(C)=C\CCCCCCCC |
| InChI | InChI=1S/C13H24/c1-4-6-7-8-9-10-11-12-13(3)5-2/h5,12H,2,4,6-11H2,1,3H3/b13-12- |
| InChIKey | ZXJDVAWSYCKMGY-SEYXRHQNSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|