About 2-methylhenicos-2-ene;dihydrobromide
2-methylhenicos-2-ene;dihydrobromide (PubChem CID 175068359) has the molecular formula C22H46Br2
and a molecular weight of 470.42 g/mol. Its IUPAC name is 2-methylhenicos-2-ene;dihydrobromide.
Molecular Properties
| Compound Name | 2-methylhenicos-2-ene;dihydrobromide |
| PubChem CID | 175068359 |
| Molecular Formula | C22H46Br2 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-methylhenicos-2-ene;dihydrobromide |
| SMILES | Br.Br.CCCCCCCCCCCCCCCCCCC=C(C)C |
| InChI | InChI=1S/C22H44.2BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)3;;/h21H,4-20H2,1-3H3;2*1H |
| InChIKey | AAKVDCKDHVVTFS-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhenicos-2-ene;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhenicos-2-ene;dihydrobromide?
The IUPAC name of 2-methylhenicos-2-ene;dihydrobromide (CID 175068359) is 2-methylhenicos-2-ene;dihydrobromide.
What is the SMILES notation for 2-methylhenicos-2-ene;dihydrobromide?
The canonical SMILES for 2-methylhenicos-2-ene;dihydrobromide is Br.Br.CCCCCCCCCCCCCCCCCCC=C(C)C.
What is the InChIKey of 2-methylhenicos-2-ene;dihydrobromide?
The InChIKey is AAKVDCKDHVVTFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44.2BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)3;;/h21H,4-20H2,1-3H3;2*1H.
What are the key properties of 2-methylhenicos-2-ene;dihydrobromide?
2-methylhenicos-2-ene;dihydrobromide has a molecular weight of 470.42 g/mol, XLogP of 9.76, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhenicos-2-ene;dihydrobromide is sourced from PubChem (CID 175068359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).