C19H38O2 — CID 13420628
(7R,8S)-2-methyloctadec-2-ene-7,8-diol (PubChem CID 13420628) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is (7R,8S)-2-methyloctadec-2-ene-7,8-diol.
| Compound Name | (7R,8S)-2-methyloctadec-2-ene-7,8-diol |
|---|---|
| PubChem CID | 13420628 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | (7R,8S)-2-methyloctadec-2-ene-7,8-diol |
| SMILES | CCCCCCCCCC[C@H](O)[C@H](O)CCCC=C(C)C |
| InChI | InChI=1S/C19H38O2/c1-4-5-6-7-8-9-10-11-15-18(20)19(21)16-13-12-14-17(2)3/h14,18-21H,4-13,15-16H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | PXUKLOFVJCMJML-RBUKOAKNSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|