About (Z)-octacos-19-ene-10,11-diol
(Z)-octacos-19-ene-10,11-diol (PubChem CID 87651448) has the molecular formula C28H56O2
and a molecular weight of 424.75 g/mol. Its IUPAC name is (Z)-octacos-19-ene-10,11-diol.
Molecular Properties
| Compound Name | (Z)-octacos-19-ene-10,11-diol |
| PubChem CID | 87651448 |
| Molecular Formula | C28H56O2 |
| Molecular Weight | 424.75 g/mol |
| Exact Mass | 424.43 |
| IUPAC Name | (Z)-octacos-19-ene-10,11-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(O)C(O)CCCCCCCCC |
| InChI | InChI=1S/C28H56O2/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-26-28(30)27(29)25-23-21-19-10-8-6-4-2/h14-15,27-30H,3-13,16-26H2,1-2H3/b15-14- |
| InChIKey | JZHQUQWPNKGDPK-PFONDFGASA-N |
| XLogP | 8.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.75 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octacos-19-ene-10,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octacos-19-ene-10,11-diol?
The IUPAC name of (Z)-octacos-19-ene-10,11-diol (CID 87651448) is (Z)-octacos-19-ene-10,11-diol.
What is the SMILES notation for (Z)-octacos-19-ene-10,11-diol?
The canonical SMILES for (Z)-octacos-19-ene-10,11-diol is CCCCCCCC/C=C\CCCCCCCC(O)C(O)CCCCCCCCC.
What is the InChIKey of (Z)-octacos-19-ene-10,11-diol?
The InChIKey is JZHQUQWPNKGDPK-PFONDFGASA-N. The full InChI is InChI=1S/C28H56O2/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-26-28(30)27(29)25-23-21-19-10-8-6-4-2/h14-15,27-30H,3-13,16-26H2,1-2H3/b15-14-.
What are the key properties of (Z)-octacos-19-ene-10,11-diol?
(Z)-octacos-19-ene-10,11-diol has a molecular weight of 424.75 g/mol, XLogP of 8.89, 24 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octacos-19-ene-10,11-diol is sourced from PubChem (CID 87651448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).