C19H36O2 — CID 20847648
(9E)-nonadeca-9,18-diene-6,7-diol (PubChem CID 20847648) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is (9E)-nonadeca-9,18-diene-6,7-diol.
| Compound Name | (9E)-nonadeca-9,18-diene-6,7-diol |
|---|---|
| PubChem CID | 20847648 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (9E)-nonadeca-9,18-diene-6,7-diol |
| SMILES | C=CCCCCCCC/C=C/CC(O)C(O)CCCCC |
| InChI | InChI=1S/C19H36O2/c1-3-5-7-8-9-10-11-12-13-15-17-19(21)18(20)16-14-6-4-2/h3,13,15,18-21H,1,4-12,14,16-17H2,2H3/b15-13+ |
| InChIKey | DJFPWUBTBKGAGA-FYWRMAATSA-N |
| XLogP | 5.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|