C21H40 — CID 123270999
13,14-dimethylnonadeca-1,10-diene (PubChem CID 123270999) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 13,14-dimethylnonadeca-1,10-diene.
| Compound Name | 13,14-dimethylnonadeca-1,10-diene |
|---|---|
| PubChem CID | 123270999 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 13,14-dimethylnonadeca-1,10-diene |
| SMILES | C=CCCCCCCCC=CCC(C)C(C)CCCCC |
| InChI | InChI=1S/C21H40/c1-5-7-9-10-11-12-13-14-15-17-19-21(4)20(3)18-16-8-6-2/h5,15,17,20-21H,1,6-14,16,18-19H2,2-4H3 |
| InChIKey | OOYSXSOQIBCMRI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|