C14H24 — CID 59685224
(9Z)-9-ethyl-5-methylundeca-1,5,9-triene (PubChem CID 59685224) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (9Z)-9-ethyl-5-methylundeca-1,5,9-triene.
| Compound Name | (9Z)-9-ethyl-5-methylundeca-1,5,9-triene |
|---|---|
| PubChem CID | 59685224 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (9Z)-9-ethyl-5-methylundeca-1,5,9-triene |
| SMILES | C=CCCC(C)=CCC/C(=C\C)CC |
| InChI | InChI=1S/C14H24/c1-5-8-10-13(4)11-9-12-14(6-2)7-3/h5-6,11H,1,7-10,12H2,2-4H3/b13-11?,14-6- |
| InChIKey | WPLWJTXLUGXQTB-UNHUZSPNSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|