C11H21N — CID 79599857
N-ethyl-4-methylocta-3,7-dien-1-amine (PubChem CID 79599857) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is N-ethyl-4-methylocta-3,7-dien-1-amine.
| Compound Name | N-ethyl-4-methylocta-3,7-dien-1-amine |
|---|---|
| PubChem CID | 79599857 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N-ethyl-4-methylocta-3,7-dien-1-amine |
| SMILES | C=CCCC(C)=CCCNCC |
| InChI | InChI=1S/C11H21N/c1-4-6-8-11(3)9-7-10-12-5-2/h4,9,12H,1,5-8,10H2,2-3H3 |
| InChIKey | IAWSHAQGZWBDNC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|